| Identification | Back Directory | [Name]
Fmoc-Cys(STmp)-OH | [CAS]
1403834-74-1 | [Synonyms]
Fmoc-Cys(STmp)-OH Fmoc-L-Cys(STmp)-OH Fmoc-Cys(STmp)-OH(non-animal) Fmoc-Cys(STmp)-OH (Non-Animal Origin) (9H-Fluoren-9-yl)MethOxy]Carbonyl Cys(STmp)-OH (Non-Animal Origin) L-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-[(2,4,6-trimethoxyphenyl)dithio]- (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-((2,4,6-trimethoxyphenyl)disulfanyl)propanoic acid (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[(2,4,6-trimethoxyphenyl)disulfanyl]propanoic acid | [Molecular Formula]
C27H27NO7S2 | [MDL Number]
MFCD27957369 | [MOL File]
1403834-74-1.mol | [Molecular Weight]
541.64 |
| Chemical Properties | Back Directory | [Boiling point ]
742.3±60.0 °C(Predicted) | [density ]
1.40±0.1 g/cm3(Predicted) | [storage temp. ]
15-25°C | [form ]
Powder | [pka]
3.31±0.10(Predicted) | [color ]
White to off-white | [Major Application]
peptide synthesis | [InChIKey]
GADCBXMSWHDNAU-QFIPXVFZSA-N | [SMILES]
S(Sc4c(cc(cc4OC)OC)OC)C[C@H](NC(=O)OCC1c2c(cccc2)c3c1cccc3)C(=O)O |
| Hazard Information | Back Directory | [Uses]
Fmoc-Cys(STmp)-OH is a specialized chemical compound that integrates a cysteine amino acid with two distinct protecting groups: the Fmoc (9-fluorenylmethoxycarbonyl) group and the S-tritylthiol (STmp) group. Fmoc-Cys(STmp)-OH is designed to enhance the stability and reactivity control during the synthesis of peptides, making it an essential component in peptide chemistry. | [reaction suitability]
reaction type: Fmoc solid-phase peptide synthesis |
|
|