| Identification | Back Directory | [Name]
[4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
| [CAS]
141836-50-2 | [Synonyms]
[4-(tert-Butyldimethylsilyloxymethyl)cyclohexyl]methanol
4-[[[(1,1-DiMethylethyl)diMethylsilyl]oxy]Methyl]cyclohexaneMethanol trans-[4-(tert-butyl-dimethyl-silanyloxymethyl)-cyclohexyl]-methanol CyclohexaneMethanol, 4-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]Methyl]- | [Molecular Formula]
C14H30O2Si | [MOL File]
141836-50-2.mol | [Molecular Weight]
258.47 |
| Chemical Properties | Back Directory | [Boiling point ]
301.4±15.0 °C(Predicted) | [density ]
0.899±0.06 g/cm3(Predicted) | [storage temp. ]
Storage temp. 2-8°C | [pka]
15.05±0.10(Predicted) | [Appearance]
Colorless to light yellow Oil | [InChI]
InChI=1S/C14H30O2Si/c1-14(2,3)17(4,5)16-11-13-8-6-12(10-15)7-9-13/h12-13,15H,6-11H2,1-5H3 | [InChIKey]
DWUPTNCOHZJANV-UHFFFAOYSA-N | [SMILES]
C1(CO)CCC(CO[Si](C(C)(C)C)(C)C)CC1 |
| Hazard Information | Back Directory | [Chemical Properties]
Colourless Oil | [Uses]
Intermediate in the production of Rho kinase inhibitors and neurite outgrowth promoters. |
|
| Company Name: |
Pharmalego Gold
|
| Tel: |
18321033991 |
| Website: |
https://cn.pharmalego.com/ |
| Company Name: |
SPIRO PHARMA
|
| Tel: |
|
| Website: |
www.spiropharma.com.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
|