| Chemical Properties | Back Directory | [Melting point ]
130 °C | [Boiling point ]
357.3±37.0 °C(Predicted) | [density ]
1.230±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,2-8°C | [InChI]
InChI=1S/C9H11NO5/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12/h4-5H,1-3H3 | [InChIKey]
SXVFZZZETDRISD-UHFFFAOYSA-N | [SMILES]
C1(OC)=CC([N+]([O-])=O)=C(OC)C=C1OC |
| Hazard Information | Back Directory | [Chemical Properties]
Yellow needle-shaped crystals (ethanol). Melting point 130℃. | [Uses]
1,2,4-Trimethoxy-5-nitrobenzene is used in the synthesis of streptonigrone via one-step construction of substituted pyridones and Conrad-Limpach reaction. |
|
| Company Name: |
SIMAGCHEM CORP
|
| Telephone: |
+86-5922680277 +86-13806087780 |
| Website: |
http://www.simagchem.com/ |
| Company Name: |
Aromsyn Co., Ltd.
|
| Telephone: |
+86-0571-85585865 +86-13336024896 |
| Website: |
https://www.aromsyn.com/ |
|