| Identification | Back Directory | [Name]
Boc-2-Methoxy-L-Phenylalanine | [CAS]
143415-63-8 | [Synonyms]
Boc-L-Phe(2-OMe)-OH
Boc-2-Methoxy-L-Phenylalanine
Boc-2-methoxy-L-phenylalanine 97%
(Tert-Butoxy)Carbonyl 2-Methoxy-L-Phenylalanine
L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2-methoxy-
(S)-2-TERT-BUTHOXYCARBONYLAMINO-3-(2-METHOXY-PHENYL)-PROPIONIC ACID
(S)-2-((tert-Butoxycarbonyl)amino)-3-(2-methoxyphenyl)propanoic acid
(2S)-2-{[(tert-butoxy)carbonyl]amino}-3-(2-methoxyphenyl)propanoic acid | [Molecular Formula]
C15H21NO5 | [MDL Number]
MFCD01860640 | [MOL File]
143415-63-8.mol | [Molecular Weight]
295.33 |
| Chemical Properties | Back Directory | [Melting point ]
157°C | [Boiling point ]
451.664±40.00 °C(Press: 760.00 Torr)(predicted) | [density ]
1.169±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | [storage temp. ]
2-8°C | [form ]
powder | [pka]
3.956±0.11(predicted) | [color ]
White to off-white | [Major Application]
peptide synthesis | [InChI]
1S/C15H21NO5/c1-15(2,3)21-14(19)16-11(13(17)18)9-10-7-5-6-8-12(10)20-4/h5-8,11H,9H2,1-4H3,(H,16,19)(H,17,18)/t11-/m0/s1 | [InChIKey]
QMHKMTAKTUUKEK-NSHDSACASA-N | [SMILES]
OC([C@@H](NC(OC(C)(C)C)=O)CC1=CC=CC=C1OC)=O |
| Hazard Information | Back Directory | [Uses]
Unnatural amino acid was derived from a C-H Activation methodology developed by Jin-Quan Yu and coworkers. The Pd-mediated C-C bond formation can be made in tandem with 2-Methylpyridine (Aldrich 109835). | [reaction suitability]
reaction type: Boc solid-phase peptide synthesis
reagent type: ligand
reaction type: C-H Activation |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Struchem Co., Ltd.
|
| Tel: |
0512-63009836 18994340901 |
| Website: |
http://www.beidapharma.com |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|