| Identification | Back Directory | [Name]
CROCONIC ACID, DISODIUM SALT | [CAS]
14379-00-1 | [Synonyms]
Croconic acid (sodium) CROCONIC ACID, DISODIUM SALT Croconic acid disodium salt 97% isodium,3,4,5-trioxocyclopentene-1,2-diolate disodium:3,4,5-trioxocyclopentene-1,2-diolate 4,5-Dihydroxy-cyclopent-4-ene-1,2,3-trione disodiumsalt 4,5-DIHYDROXY-4-CYCLOPENTENE-1,2,3-TRIONE, DISODIUM SALT 4-Cyclopentene-1,2,3-trione,4,5-dihydroxy-, sodium salt (1:2) | [Molecular Formula]
C5Na2O5 | [MDL Number]
MFCD00191954 | [MOL File]
14379-00-1.mol | [Molecular Weight]
186.03 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C(lit.)
| [storage temp. ]
Store at room temperature, keep dry and cool | [form ]
solid | [color ]
Light yellow to yellow | [InChI]
InChI=1S/C5H2O5.Na.H/c6-1-2(7)4(9)5(10)3(1)8;;/h6-7H;; | [InChIKey]
QCLSLONXNVWZIU-UHFFFAOYSA-N | [SMILES]
O=C1C(C(O)=C(O)C1=O)=O.[NaH] |
| Hazard Information | Back Directory | [Uses]
Croconic acid (disodium) (Nacr) can promote cell growth and proliferation by enhancing the expression of genes associated with lysine crotonylation (Kcr) modification. Croconic acid holds potential for improving somatic cell nuclear transfer (SCNT) efficiency and optimizing cell culture conditions research[1] | [References]
[1] Zhao X, et al. High histone crotonylation modification in bovine fibroblasts promotes cell proliferation and the developmental efficiency of preimplantation nuclear transfer embryos. Sci Rep. 2024 May 4;14(1):10295. DOI:10.1038/s41598-024-61148-6 |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|