| Identification | Back Directory | [Name]
N-EPSILON-2,4-DNP-L-LYSINE HYDROCHLORIDE | [CAS]
14401-10-6 | [Synonyms]
dnp-lys-oh.hcl H-Lys(Dnp)-OH·HCl EPSILON-DNP-L -LYSINE ε-DNP-L-Lysine hydrochloride nε-dnp-l-lysine hydrochloride NE-2,4-DNP-L-LYSINEHYDROCHLORIDE Dinitrophenyllysinehydrochloride EPSILON-DNP-L-LYSINE HYDROCHLORIDE NEPSILON-DNP-L-LYSINE HYDROCHLORIDE N-EPSILON-2,4-DNP-L-LYSINE HYDROCHLORIDE nε-(2,4-dinitrophenyl)-l-lysine hydrochloride EPSILON-2 4-DINITROPHENYL-L-LYSINE HYDROCHLORIDE N6-(2,4-dinitrophenyl)-L-lysine monohydrochloride Nepsilon-Dnp-L-lysine Hydrochloride
Dnp-Lys-OH.HCl NEPSILON-(2,4-DINITROPHENYL)-L-LYSINE HYDROCHLORIDE N^(epsilum)-(2,4-Dinitrophenyl)-L-lysine hydrochloride -(2,4-Dinitrophenyl)-L-lysine Hydrochloride ?-DNP-L-Lysine hydrochloride ?-2,4-Dinitrophenyl-L-lysine hydrochloride | [EINECS(EC#)]
238-366-0 | [Molecular Formula]
C12H17ClN4O6 | [MDL Number]
MFCD00036383 | [MOL File]
14401-10-6.mol | [Molecular Weight]
348.74 |
| Chemical Properties | Back Directory | [Melting point ]
103-105 °C | [refractive index ]
19 ° (C=2, MeOH) | [storage temp. ]
−20°C
| [form ]
powder to crystal | [color ]
Light yellow to Yellow to Orange | [InChI]
1S/C12H16N4O6.ClH/c13-9(12(17)18)3-1-2-6-14-10-5-4-8(15(19)20)7-11(10)16(21)22;/h4-5,7,9,14H,1-3,6,13H2,(H,17,18);1H | [InChIKey]
VDVXDUOPLKVMMM-UHFFFAOYSA-N | [SMILES]
OC([C@@H](N)CCCCNC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1)=O.[H]Cl |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Website: |
https://www.chemicalbook.com/supplier/10480342/ |
|