| Identification | Back Directory | [Name]
BENZYL (E)-2-(2-OXOBENZOFURAN-3(2H)-YLIDENE)ACETATE | [CAS]
1440545-28-7 | [Synonyms]
BENZYL (E)-2-(2-OXOBENZOFURAN-3(2H)-YLIDENE)ACETATE
Benzyl (E)-2-(2-oxobenzofuran-3(2H)-ylidene)acetate 95% (HPLC)
Acetic acid, 2-(2-oxo-3(2H)-benzofuranylidene)-, phenylmethyl ester, (2E)- | [Molecular Formula]
C17H12O4 | [MDL Number]
MFCD29037031 | [MOL File]
1440545-28-7.mol | [Molecular Weight]
280.27 |
| Chemical Properties | Back Directory | [Boiling point ]
465.0±45.0 °C(Predicted) | [density ]
1.374±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
flakes | [InChI]
1S/C17H12O4/c18-16(20-11-12-6-2-1-3-7-12)10-14-13-8-4-5-9-15(13)21-17(14)19/h1-10H,11H2/b14-10+ | [InChIKey]
HXSOJKAKJXISCE-GXDHUFHOSA-N | [SMILES]
O=C(OCC1=CC=CC=C1)/C=C(C2=C(O3)C=CC=C2)/C3=O |
| Hazard Information | Back Directory | [Uses]
Building block used as a substrate in phosphine-catalyzed domino sequences. This versatile compound can be used to synthesize a wide scope of spirocyclic benzofuranone scaffolds. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|