| Identification | Back Directory | [Name]
3-(1H-benzo[d]imidazol-2-yl)quinoline-2,4-diol | [CAS]
144335-37-5 | [Synonyms]
3-(1H-benzo[d]imidazol-2-yl)quinoline-2,4-diol | [Molecular Formula]
C16H11N3O2 | [MDL Number]
MFCD00572729 | [MOL File]
144335-37-5.mol | [Molecular Weight]
277.28 |
| Chemical Properties | Back Directory | [density ]
1.499±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
DMSO: 5mg/mL | [form ]
solid | [pka]
4.50±1.00(Predicted) | [color ]
off-white | [InChI]
1S/C16H11N3O2/c20-14-9-5-1-2-6-10(9)19-16(21)13(14)15-17-11-7-3-4-8-12(11)18-15/h1-8H,(H,17,18)(H2,19,20,21) | [InChIKey]
YXCWBNCDJZEBKY-UHFFFAOYSA-N | [SMILES]
[nH]1c2c(nc1c3c(nc4c(c3O)cccc4)O)cccc2 |
| Hazard Information | Back Directory | [Description]
FGF/PDGF/VEGF RTK Inhibitor is a potent, reversible, atp-competitive inhibitor against pdgfrβ, fgfr-1, and vegfr-2 (ic50 = 20, 90, and 240 nm, respectively) and effectively suppresses vegf-stimulated proliferation of hmvecs (ec50 = 420 nm). |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
PHARMEKS Ltd.
|
| Tel: |
+7 (495) 702-9648 |
| Website: |
www.pharmeks.com |
|