| Identification | Back Directory | [Name]
(-)-TROGER'S BASE | [CAS]
14645-24-0 | [Synonyms]
(-)-TRGER'S BASE
(-)-TROGER'S BASE
(S)-2,8-dimethyl-5,11-methanodibenzo (B,F)(1,5)diazocin
(5S,11S)-(-)-2,8-DIMETHYL-6H,12H-5,11-METHANODIBENZO[B,F][1,5]DIAZOCIN
6H,12H-5,11-Methanodibenzo[b,f][1,5]diazocine, 2,8-dimethyl-, (5R,11R)- | [Molecular Formula]
C17H18N2 | [MDL Number]
MFCD00151116 | [MOL File]
14645-24-0.mol | [Molecular Weight]
250.34 |
| Chemical Properties | Back Directory | [Melting point ]
127-131 °C | [Boiling point ]
461.0±45.0 °C(Predicted) | [density ]
1.21±0.1 g/cm3(Predicted) | [pka]
4.53±0.20(Predicted) | [Optical Rotation]
[α]20/D 283±4°, c = 0.3% in hexane | [BRN ]
88611 | [InChI]
1S/C17H18N2/c1-12-3-5-16-14(7-12)9-18-11-19(16)10-15-8-13(2)4-6-17(15)18/h3-8H,9-11H2,1-2H3 | [InChIKey]
SXPSZIHEWFTLEQ-UHFFFAOYSA-N | [SMILES]
Cc1ccc2[N@@H]3C[N@H](Cc2c1)c4ccc(C)cc4C3 |
| Hazard Information | Back Directory | [Uses]
It was used as an standard analyte for testing the enantioseparation capability of the chiral stationary phase column; in a study to understand the covalently bonded cellulose tris(3,5-dimethylphenylcarbamate) on a silica monolithic capillary column. | [General Description]
Tr?ger base (TB) is a chiral heterocyclic amine with chirality due to the presence of two stereogenic nitrogen atoms. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Interchim S.A.
|
| Tel: |
(33) 4 70 03 88 55 |
| Website: |
www.interchim.com |
|