| Identification | Back Directory | [Name]
3,5,6,7-tetrahydro-s-Indacen-1(2H)-one | [CAS]
14927-64-1 | [Synonyms]
3,5,6,7-Tetrahydro-s-indacen-1-one 3,5,6,7-tetrahydro-2H-s-indacen-1-one 2,3,6,7-TETRAHYDRO-S-INDACEN-1(5H)-ONE 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one s-Indacen-1(2H)-one, 3,5,6,7-tetrahydro- 2,3,6,7-tetrahydro-s-indacen-1(5H)-one(WXC05571) | [Molecular Formula]
C12H12O | [MDL Number]
MFCD09866841 | [MOL File]
14927-64-1.mol | [Molecular Weight]
172.22 |
| Chemical Properties | Back Directory | [Melting point ]
80-81 °C | [Boiling point ]
326.1±42.0 °C(Predicted) | [density ]
1.195±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C12H12O/c13-12-5-4-10-6-8-2-1-3-9(8)7-11(10)12/h6-7H,1-5H2 | [InChIKey]
LXDKNEXOGZDIAC-UHFFFAOYSA-N | [SMILES]
C1(=O)C2=C(C=C3C(=C2)CCC3)CC1 |
| Hazard Information | Back Directory | [Uses]
3,5,6,7-Tetrahydro-s-indacen-1-one, is an intermediate in the synthesis of 4-Nitro-3,5,6,7-tetrahydro-2H-S-indacen-1-one (N565125). |
|
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|