| Identification | Back Directory | [Name]
2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158 | [CAS]
154554-41-3 | [Synonyms]
CHM 1
NSC 656158
CHM-1 hydrate
6-(2-Fluorophenyl)-1,3-dioxolo[4,5-g]quinolin-8(5H)-one
6-(2-Fluoro-phenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one
1,3-Dioxolo[4,5-g]quinolin-8(5H)-one, 6-(2-fluorophenyl)-
2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate
2-(2-fluorophenyl)-6,7-methylenedioxy-2-4-quinolone hydrate, NSC 656158
Inhibitor,microtubule-destabilizing,Cdc2,carcinoma,CHM1,NSC-656158,Microtubule/Tubulin,hepatocellular,NSC656158,antitumor,inhibit,CHM-1,CHM 1,antimitotic,NSC 656158 | [Molecular Formula]
C16H10FNO3 | [MDL Number]
MFCD11114577 | [MOL File]
154554-41-3.mol | [Molecular Weight]
283.25 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [solubility ]
DMSO: ≥5mg/mL | [form ]
solid | [color ]
Off-white to light yellow | [InChI]
1S/C16H10FNO3.H2O/c17-11-4-2-1-3-9(11)12-6-14(19)10-5-15-16(21-8-20-15)7-13(10)18-12;/h1-7H,8H2,(H,18,19);1H2 | [InChIKey]
KIAVGSCBJYDTIM-UHFFFAOYSA-N | [SMILES]
O.Fc1ccccc1C2=CC(=O)c3cc4OCOc4cc3N2 |
| Hazard Information | Back Directory | [Uses]
CHM-1 is a potent apoptosis inducer. | [Biological Activity]
CHM-1 possess antimitotic,antiangiogenic and antitumor activity. It is a potent and selective antitumor agent in human hepatocellular carcinoma. CHM-1 induces apoptosisand it binds tubulin and inhibits tubulin polymerization. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|