| Identification | Back Directory | [Name]
Binap Pd G4 | [CAS]
1599466-90-6 | [Synonyms]
Binap Pd G4 Methanesulfonato [(±)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene] (2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) | [Molecular Formula]
C58H47NO3P2PdS | [MDL Number]
MFCD31707673 | [MOL File]
1599466-90-6.mol | [Molecular Weight]
1006.45 |
| Chemical Properties | Back Directory | [form ]
solid | [InChIKey]
PNOKGRADISJRPD-UHFFFAOYSA-N | [SMILES]
P(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC2C=CC=CC=2C=1C1C2C=CC=CC=2C=CC=1P(C1C=CC=CC=1)C1C=CC=CC=1)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| Hazard Information | Back Directory | [Uses]
A powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. Bench stable, soluble in most organic solvents. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings |
|
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|