| Identification | Back Directory | [Name]
5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine | [CAS]
160240-15-3 | [Synonyms]
5,10,15,20-tetra(4-ethynylphenyl)porphyrin 5,10,15,20-tetrakis(4-ethynylphenyl)-21H,23H-Porphine 21H,23H-Porphine, 5,10,15,20-tetrakis(4-ethynylphenyl)- | [Molecular Formula]
C52H30N4 | [MDL Number]
MFCD31700791 | [MOL File]
160240-15-3.mol | [Molecular Weight]
710.82 |
| Chemical Properties | Back Directory | [density ]
1.37±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [Appearance]
Pale purple to purple Powder | [InChIKey]
CWGZUDCLBKTFEM-RCOMQYLTSA-N | [SMILES]
C1(C2=CC=C(C#C)C=C2)=C2N=C(C(C3=CC=C(C#C)C=C3)=C3NC(=C(C4=CC=C(C#C)C=C4)C4=NC(=C(C5=CC=C(C#C)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:22,t:9,25,38| |
| Hazard Information | Back Directory | [Uses]
5,10,15,20-Tetrakis(4-ethynylphenyl)-21H,23H-Porphine is used as a ligand in the synthesis of COF materials: Ni-Por-1/2/3/4; MZnP. |
|
| Company Name: |
LaaJoo
|
| Telephone: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|