| Identification | Back Directory | [Name]
Iridium(1+),[4,4'-bis(1,1-dimethylethyl)-2,2'-bipyridine-κN1,κN1']bis[5-methyl-2-(4-methyl-2-pyridinyl-κN)phenyl-κC]-,(OC-6-33)-, hexafluorophosphate(1-)(1:1) | [CAS]
1607469-49-7 | [Synonyms]
Ir(dmppy)2(dtbbpy)PF6 4,4'-Bis(t-butyl-2,2'-bipyridine]bis[5-methyl-2-(4-methyl-2-pyridinyl-kN)phenyl-kC]iridium hexafluorophosphate, 95% Iridium(1+),[4,4'-bis(1,1-dimethylethyl)-2,2'-bipyridine-κN1,κN1']bis[5-methyl-2-(4-methyl-2-pyridinyl-κN)phenyl-κC]-,(OC-6-33)-, hexafluorophosphate(1-)(1:1) | [Molecular Formula]
C44H48F6IrN4P | [MOL File]
1607469-49-7.mol | [Molecular Weight]
970.08 |
| Chemical Properties | Back Directory | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
Powder | [color ]
yellow | [Sensitive ]
air sensitive | [InChIKey]
SFJOCOJKUUPWQQ-UHFFFAOYSA-N | [SMILES]
[P+5]([F-])([F-])([F-])([F-])([F-])[F-].CC1=CC=C2C3=CC(C)=CC=N3[Ir+3]34([C-]5=CC(C)=CC=C5C5=CC(C)=CC=N35)(N3=CC=C(C(C)(C)C)C=C3C3=CC(C(C)(C)C)=CC=N43)[C-]2=C1 |
| Hazard Information | Back Directory | [Uses]
(Ir[Me(Me)ppy]2(dtbpy))PF6 or Ir(dmppy)2(dtbbpy)PF6 is an iridium photoredox catalyst that facilitates a variety of transformations using visible light, including the α- and β-alkylation of aldehydes. | [reaction suitability]
core: iridium reagent type: catalyst reaction type: Photocatalysis |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|