| Identification | Back Directory | [Name]
2-BUTYL-1,3,2-DIOXABOROLANE-4S,5S-DICARBOXYLIC ACID BIS(DIMETHYLAMIDE) | [CAS]
161344-84-9 | [Synonyms]
2-Butyl-1 2-dioxaborolane-4S 5S-dicarboxylicacid bis(diMethylaMide) Butylboronic acid N,N,N',N'-tetrameth 2-Butyl-1,3,2-dioxaborolane-4S,5S-dicarboxylic 2-BUTYL-1,3,2-DIOXABOROLANE-4S,5S-DICARBOXYLIC ACID BIS(DIMETHYLAMIDE) 2-BUTYL-N,N,N',N'-TETRAMETHYL-1,3,2-DIOXABOROLANE-(4S,5S)-DICARBOXAMIDE Butylboronic acid N,N,N',N'-tetraMethyl-D-tartaric acid diaMide ester 97% (4S,5S)-2-BUTYL-N,N,N'N'-TETRAMETHYL-1,3,2-DIOXABOROLANE-4,5-DICARBOXAMIDE Butylboronic acid N,N,N',N'-tetramethyl-D-tartaric acid diamide ester, 97% (4S,5S)-2-Butyl-N4,N4,N5,N5-tetraMethyl-1,3,2-dioxaborolane-4,5-dicarboxaMide (4S,5S)-2-butyl-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide 1,3,2-Dioxaborolane-4,5-dicarboxamide, 2-butyl-N4,N4,N5,N5-tetramethyl-, (4S,5S)- | [Molecular Formula]
C12H23BN2O4 | [MDL Number]
MFCD05663838 | [MOL File]
161344-84-9.mol | [Molecular Weight]
270.13 |
| Chemical Properties | Back Directory | [Boiling point ]
305-306 °C (lit.) | [density ]
1.096 g/mL at 25 °C (lit.) | [refractive index ]
n20/D 1.4780(lit.)
| [Fp ]
>230 °F
| [storage temp. ]
Inert atmosphere,2-8°C | [pka]
-0.81±0.40(Predicted) | [Appearance]
Colorless to light yellow Liquid | [Optical Rotation]
[α]20/D +106°, c = 1% in chloroform | [InChI]
1S/C12H23BN2O4/c1-6-7-8-13-18-9(11(16)14(2)3)10(19-13)12(17)15(4)5/h9-10H,6-8H2,1-5H3/t9-,10-/m0/s1 | [InChIKey]
AFQWQRBBIZKYTE-UWVGGRQHSA-N | [SMILES]
CCCCB1O[C@@H]([C@H](O1)C(=O)N(C)C)C(=O)N(C)C |
| Hazard Information | Back Directory | [Uses]
Butylboronic acid N,N,N′,N′-tetramethyl-D-tartaric acid diamide is a dioxaborolane ligand that can be used to prepare:
- Enantioenriched spiropentanes via zinc catalyzed cyclopropanation of corresponding hydroxymethylallenes.
- 1,2,3-trisubstituted cyclopropane derivatives by asymmetric cyclopropanation of allylic alcohols in the presence of zinc reagents.
- Glycolipids plakosides A, B, and their derivatives by Sharpless asymmetric dihydroxylation and cyclopropanation reaction.
|
|
| Company Name: |
AllyChem Co., Ltd.
|
| Tel: |
0411-62313318 13889470786 |
| Website: |
www.chemicalbook.com/showsupplierproductslist677/0_en.htm |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|