| Identification | Back Directory | [Name]
9-mesityl-10-phenylacridin-10-ium tetrafluoroborate | [CAS]
1621019-96-2 | [Synonyms]
9-MesityL
-10-phenyL
acridinium TetrafL
9-mesityl-10-phenylacridin-10-ium tetrafluoroborate | [Molecular Formula]
C28H24BF4N | [MDL Number]
MFCD28411687 | [MOL File]
1621019-96-2.mol | [Molecular Weight]
461.301 |
| Chemical Properties | Back Directory | [Melting point ]
>200 °C | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
solid | [Appearance]
Yellow to brown Solid | [InChI]
1S/C28H24N.BF4/c1-19-17-20(2)27(21(3)18-19)28-23-13-7-9-15-25(23)29(22-11-5-4-6-12-22)26-16-10-8-14-24(26)28;2-1(3,4)5/h4-18H,1-3H3;/q+1;-1 | [InChIKey]
LGNMSOXRNBFBGX-UHFFFAOYSA-N | [SMILES]
CC(C=C1C)=CC(C)=C1C2=C3C(C=CC=C3)=[N+](C4=CC=CC=C4)C5=CC=CC=C52.F[B-](F)(F)F |
| Hazard Information | Back Directory | [Uses]
9-Mesityl-10-phenylacridinium Tetrafluoroborate is a compound derived from Acridine (A190900), a quinoline derivative used as manufacturing dyes and intermediates for antileishmanial agents. | [reaction suitability]
core: acridinium
reagent type: catalyst
reaction type: Photocatalysis |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|