| Identification | Back Directory | [Name]
RATJADONE A | [CAS]
163564-92-9 | [Synonyms]
RATJADON RATJADONE RATJADONE A 2H-Pyran-2-one, 5,6-dihydro-6-[(1E,3Z,5R,7E,9E,11R)-11-hydroxy-3,5,7-trimethyl-11-[(2S,4R,5S,6S)-tetrahydro-4-hydroxy-5-methyl-6-(1E)-1-propen-1-yl-2H-pyran-2-yl]-1,3,7,9-undecatetraen-1-yl]-, (6R)- | [Molecular Formula]
C28H40O5 | [MDL Number]
MFCD32705544 | [MOL File]
163564-92-9.mol | [Molecular Weight]
456.61 |
| Chemical Properties | Back Directory | [storage temp. ]
-70°C | [solubility ]
aqueous buffer: ≤100μM methanol: 20mg/mL | [form ]
Clear liquid. | [InChIKey]
CAYGMWMWJUFODP-AYFTZVAISA-N | [SMILES]
O1[C@H]([C@H]([C@@H](C[C@H]1[C@H](O)\C=C\C=C(\C[C@@H](C)\C=C(\C)/C=C/[C@@H]2OC(=O)C=CC2)/C)O)C)\C=C\C |
| Safety Data | Back Directory | [WGK Germany ]
WGK 2 | [Storage Class]
3 - Flammable liquids | [Hazard Classifications]
Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Hazard Information | Back Directory | [Uses]
Ratjadone A, Synthetic is a cell-permeable polyketide that inhibits cell proliferation. | [Biological Activity]
Cell permeable: yes''Primary Target nuclear export of LR-NES''Product does not compete with ATP.''Reversible: no''Target IC50: ≤ 1 ng/ml for inhibiting proliferation and inducing cell cycle arrest at G1 phase |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
MOLEKULA Ltd.
|
| Tel: |
+44 (0) 1747 831066 |
| Website: |
www.molekula.co.uk |
| Company Name: |
AXXORA, LLC
|
| Tel: |
+41 (0) 61 926 8989 |
| Website: |
www.axxora.com |
| Company Name: |
www.vwrsp.com
|
| Tel: |
1-800-932-5000 |
| Website: |
www.vwrsp.com |
| Company Name: |
Kainic.com
|
| Tel: |
1- (858) 452-9925 |
| Website: |
www.kainic.com |
| Company Name: |
Alexis Corporation
|
| Tel: |
+41 61 926 8989 |
| Website: |
www.alexis-biochemicals.com |
|