| Identification | Back Directory | [Name]
DIBENZYL N,N-DIMETHYLPHOSPHORAMIDITE | [CAS]
164654-49-3 | [Synonyms]
DIBENZYL N,N-DIMETHYLPHOSPHORAMIDITE Phosphoramidous acid, N,N-dimethyl-, bis(phenylmethyl) ester | [Molecular Formula]
C16H20NO2P | [MDL Number]
MFCD00239442 | [MOL File]
164654-49-3.mol | [Molecular Weight]
289.31 |
| Chemical Properties | Back Directory | [Boiling point ]
328.2±31.0 °C(Predicted) | [density ]
1.089 g/mL at 20 °C (lit.) | [refractive index ]
n20/D 1.553 | [storage temp. ]
2-8°C | [pka]
3.52±0.70(Predicted) | [BRN ]
7427974 | [InChI]
1S/C16H20NO2P/c1-17(2)20(18-13-15-9-5-3-6-10-15)19-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 | [InChIKey]
GDEJGFHRPXLQNN-UHFFFAOYSA-N | [SMILES]
CN(C)P(OCc1ccccc1)OCc2ccccc2 |
| Hazard Information | Back Directory | [Uses]
Dibenzyl N,N-dimethylphosphoramidite is used as a synthetic reagent in the enzyme-assisted synthesis of inositol triphosphate. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-29-81139210 17389186172 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-219/ |
|