| Identification | Back Directory | [Name]
1,3-Bis(2,6-di-i-propylphenyl)-2-chloroimidazolium chloride/cesium fluoride admixture (1.0/6.7 molar ratio or 1/2.2 weight ratio) | [CAS]
1648825-53-9 | [Synonyms]
PhenoFluor&trade 2-Chloro-1,3-bis(2,6-diisopropylphenyl)-1H-imidazolium chloride - cesium fluoride 1,3-Bis(2,6-di-i-propylphenyl)-2-chloroimidazolium chloride/cesium fluoride admixture (1.0/6.7 molar ratio or 1/2.2 weight ratio) 1,3-BIS(2,6-DI-I-PROPYLPHENYL)-2-CHLOROIMIDAZOLIUM CHLORIDE/CESIUM FLUORIDE ADMIXTURE (1.0/6.7 MOLAR RATIO OR 1/2.2 WEIGHT RATIO)(W/W 1/2.2) | [Molecular Formula]
C27H36Cl2CsFN2 | [MDL Number]
MFCD29472387 | [MOL File]
1648825-53-9.mol | [Molecular Weight]
611.4 |
| Chemical Properties | Back Directory | [Melting point ]
229 °C | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C27H36ClN2.ClH.Cs.FH/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8;;;/h9-20H,1-8H3;1H;;1H/q+1;;+1;/p-2 | [InChIKey]
AHNDOFVAHQKSBA-UHFFFAOYSA-L | [SMILES]
[Cs]F.C(C1C=CC=C(C(C)C)C=1[N+]1C=CN(C2C(=CC=CC=2C(C)C)C(C)C)C=1Cl)(C)C.[Cl-] |
| Hazard Information | Back Directory | [Uses]
PhenoFluor(TM) Mix (CAS# 1648825-53-9) is a deoxyfluorinating reagent used with phenols and heterocycles to form aryl halides. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
chemmole
|
| Tel: |
400-168-9330 15013243073 |
| Website: |
http://www.chemmolemall.com/ |
|