| Identification | Back Directory | [Name]
2′-(Amino-κN)[1,1′-biphenyl]-2-yl-κC][2′-[(1,1-dimethylethyl)phenylphosphino-κP]-N2,N2,N6,N6-tetramethyl[1,1′-biphenyl]-2,6-diamine](methanesulfonato-κO)palladium | [CAS]
1661042-31-4 | [Synonyms]
2′-(Amino-κN)[1,1′-biphenyl]-2-yl-κC][2′-[(1,1-dimethylethyl)phenylphosphino-κP]-N2,N2,N6,N6-tetramethyl[1,1′-biphenyl]-2,6-diamine](methanesulfonato-κO)palladium
2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC][2'-[(1,1-dimethylethyl)phenylphosphino-κP]-N2,N2,N6,N6-tetramethyl[1,1'-biphenyl]-2,6-diamine](methanesulfonato-κO)palladium
Palladium, [2′-(amino-κN)[1,1′-biphenyl]-2-yl-κC][2′-[(1,1-dimethylethyl)phenylphosphino-κP]-N2,N2,N6,N6-tetramethyl[1,1′-biphenyl]-2,6-diamine](methanesulfonato-κO)- | [Molecular Formula]
C39H46N3O3PPdS | [MDL Number]
MFCD31560638 | [MOL File]
1661042-31-4.mol | [Molecular Weight]
774.27 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
powder | [Appearance]
Light yellow to brown Solid | [InChIKey]
IYOQFXCZIJAOED-UHFFFAOYSA-M | [SMILES]
[Pd+2]c4c(cccc4)c5c(cccc5)[N-H].P(C(C)(C)C)(c2c(cccc2)c3c(cccc3N(C)C)N(C)C)c1ccccc1.[S](=O)(=O)([O-])C |
| Hazard Information | Back Directory | [Uses]
As the Pd G3 complex, this ligand from the Buchwald group offers best-in-class performance in the arylation of sterically hindered primary amines. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|