| Identification | Back Directory | [Name]
2-(Bromomethyl)acrylonitrile | [CAS]
17200-53-2 | [Synonyms]
2-Cyanoallyl Bromide 2-(Bromomethyl)acrylonitrile 2-(bromomethyl)prop-2-enenitrile 2-Propenenitrile, 2-(bromomethyl)- | [Molecular Formula]
C4H4BrN | [MDL Number]
MFCD20621295 | [MOL File]
17200-53-2.mol | [Molecular Weight]
145.99 |
| Chemical Properties | Back Directory | [Boiling point ]
83 °C(Press: 20 Torr) | [density ]
1.520±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C4H4BrN/c1-4(2-5)3-6/h1-2H2 | [InChIKey]
YSTRHMIYRJIYSV-UHFFFAOYSA-N | [SMILES]
C(#N)C(CBr)=C |
| Hazard Information | Back Directory | [Uses]
2-Cyanoallyl Bromide can be used for radically photopolymerizable composition with high sensitivity and storage stability. |
|
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310 |
| Website: |
www.weikeqi-biotech.com/ |
|