| Identification | Back Directory | [Name]
4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine | [CAS]
173379-73-2 | [Synonyms]
4’-Azido-2’-deoxy-2’-fluoro-β-D-arabinouridine 4'-C-Azido-2'-deoxy-2'-fluoro-b-D-arabinouridine 4'-Azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine 4'-Azido-2'-deoxy-2'-fluoro-beta-D-arabinofuranosyl uracil 4'-Azido-2'-deoxy-2'-fluoro-beta-D-arabino ribofuranosyl uracil 2,4(1H,3H)-PyriMidinedione, 1-[4-C-azido-2-deoxy-2-fluoro-b-D-arabinofuranosyl]- 1-[4-C-Azido-2-deoxy-2-fluoro-beta-D-arabinofuranosyl]-2,4(1H,3H)-pyrimidinedione | [Molecular Formula]
C9H10FN5O5 | [MDL Number]
MFCD25542494 | [MOL File]
173379-73-2.mol | [Molecular Weight]
287.205 |
| Chemical Properties | Back Directory | [InChI]
InChI=1/C9H10FN5O5/c10-5-6(18)9(3-16,13-14-11)20-7(5)15-2-1-4(17)12-8(15)19/h1-2,5-7,16,18H,3H2,(H,12,17,19)/t5-,6-,7+,9+/s3 | [InChIKey]
SNWCOSVWPQSOEU-BODDTQOYNA-N | [SMILES]
N([C@]1([C@H]([C@H](F)[C@H](N2C=CC(=O)NC2=O)O1)O)CO)=[N+]=[N-] |&1:1,2,3,5,r| |
| Hazard Information | Back Directory | [Uses]
4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | [References]
[1] Connolly GP, et al. Uridine and its nucleotides: biological actions, therapeutic potentials. Trends Pharmacol Sci. 1999 May;20(5):218-25. DOI:10.1016/s0165-6147(99)01298-5 |
|
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
NewCan Biotech Limited
|
| Telephone: |
+86-571-86912261 19975279805 |
| Website: |
https://www.newcanbio.com/ |
| Company Name: |
NewCan Biotech Limited
|
| Telephone: |
+86-0571-86912261 +86-15658003402 |
| Website: |
https://www.newcanbio.com/ |
|