| Identification | Back Directory | [Name]
6-SIALYL-N-ACETYLLACTOSAMINE* | [CAS]
174757-71-2 | [Synonyms]
6'-a-Sialyl-N-acetyllactosamine 6'-SIALYL-N-ACETYLLACTOSAMINE 98+% 6'-a-Sialyl-N-acetyllactosamine sodium salt | [Molecular Formula]
C25H42N2O19 | [MDL Number]
MFCD03095513 | [MOL File]
174757-71-2.mol | [Molecular Weight]
674.602 |
| Chemical Properties | Back Directory | [Boiling point ]
1196.7±65.0 °C(Predicted) | [density ]
1.66±0.1 g/cm3(Predicted) | [storage temp. ]
room temp | [form ]
powder or crystals | [pka]
2.01±0.70(Predicted) | [color ]
colorless | [biological source]
synthetic | [InChIKey]
RPSBVJXBTXEJJG-RAMSCCQBSA-N | [SMILES]
CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[C@]3(C[C@H](O)[C@@H](NC(C)=O)[C@@H](O3)[C@H](O)[C@H](O)CO)C(O)=O)[C@H](O)[C@H](O)[C@H]2O)[C@@H]1O |
| Hazard Information | Back Directory | [Uses]
6′-Sialyl-N-acetyllactosamine is an oligosaccharide. It is reported that the level of Neu5Ac-a-(2-6)-Gal-b-(1-4)-GlcNAc increases during tumor development in transgenic mice as compared to controls. | [Definition]
ChEBI: (2R,4S,5R,6R)-5-Acetamido-2-[[(2R,3R,4S,5R,6S)-6-[(2R,3S,4R,5R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid is a member of neuraminic acids. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310; |
| Website: |
https://www.weikeqi-biotech.com/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
CHEMSWORTH
|
| Tel: |
+91-261-2397244 |
| Website: |
www.chemsworth.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|