| Identification | Back Directory | [Name]
3-[4-(BROMOMETHYL)PHENYL]-7-(DIETHYLAMIN | [CAS]
177093-58-2 | [Synonyms]
3-[4-(BROMOMETHYL)PHENYL]-7-(DIETHYLAMIN 3-[4-(bromomethyl)phenyl]-7-(diethylamino)chromen-2-one 2H-1-Benzopyran-2-one, 3-[4-(bromomethyl)phenyl]-7-(diethylamino)- | [Molecular Formula]
C20H20BrNO2 | [MDL Number]
MFCD07784444 | [MOL File]
177093-58-2.mol | [Molecular Weight]
386.28 |
| Chemical Properties | Back Directory | [Melting point ]
150-155 °C | [Boiling point ]
540.5±50.0 °C(Predicted) | [density ]
1.380±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
3.22±0.20(Predicted) | [InChI]
1S/C20H20BrNO2/c1-3-22(4-2)17-10-9-16-11-18(20(23)24-19(16)12-17)15-7-5-14(13-21)6-8-15/h5-12H,3-4,13H2,1-2H3 | [InChIKey]
WTCCANMBFQWZMY-UHFFFAOYSA-N | [SMILES]
CCN(CC)c1ccc2C=C(C(=O)Oc2c1)c3ccc(CBr)cc3 |
| Safety Data | Back Directory | [Hazard Codes ]
Xn | [Risk Statements ]
22 | [WGK Germany ]
3 | [Storage Class]
11 - Combustible Solids | [Hazard Classifications]
Acute Tox. 4 Oral Aquatic Chronic 4 |
| Hazard Information | Back Directory | [Uses]
HPLC-precolumn-derivatization reagent for carboxylic acids. Compared to classical BMC it emits at longer wavelength and has stronger fluorescence. | [Uses]
MPAC-Br is a precolumn (HPLC) derivitization reagent for use with carboxylic acids. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Chemodex Ltd.
|
| Tel: |
+41 (71) 244-4825 |
| Website: |
www.chemodex.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
CHEMICAL LAND21
|
| Tel: |
82- 2 -783 - 8063 |
| Website: |
www.chemicalland21.com |
|