| Identification | Back Directory | [Name]
CIS-3-HEXENOIC ACID | [CAS]
1775-43-5 | [Synonyms]
FEMA 3170 C3 HEXENOIC ACID CIS-3-HEXENOIC ACID (Z)-3-Hexenoic acid RARECHEM AL BE 0723 TIMTEC-BB SBB006610 (Z)-hex-3-enoicacid cis-Hydrosorbic acid (3Z)-3-Hexenoic acid (Z)-hex-2-enoic acid cis-hex-3-enoic acid 3-Hexenoic acid, (3Z)- (Z)-11-Octadecenyl acetate cis-3-hexenoic acid, (Z)-hexa-1,3-diene-1,1-diol | [EINECS(EC#)]
217-205-8 | [Molecular Formula]
C6H10O2 | [MDL Number]
MFCD00063192 | [MOL File]
1775-43-5.mol | [Molecular Weight]
114.14 |
| Chemical Properties | Back Directory | [Boiling point ]
106-110 °C (16 mmHg) | [density ]
0.965 | [FEMA ]
4493 | CIS-3-HEXENOIC ACID | [refractive index ]
1.439-1.445 | [Fp ]
108 °C | [storage temp. ]
Store at room temperature | [pka]
4.51±0.10(Predicted) | [Appearance]
Light yellow to yellow Liquid | [Odor]
at 1.00 % in propylene glycol. green grass sweaty fruity cheesy acid | [Odor Type]
green | [JECFA Number]
2181 | [InChI]
InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H,7,8)/b4-3- | [InChIKey]
XXHDAWYDNSXJQM-ARJAWSKDSA-N | [SMILES]
C(O)(=O)C/C=C\CC | [LogP]
1.60 | [EPA Substance Registry System]
3-Hexenoic acid, (3Z)- (1775-43-5) |
| Hazard Information | Back Directory | [Uses]
(3Z)-3-Hexenoic Acid is an unsaturated aliphatic acid used in the chemistry of flavors. | [Definition]
ChEBI: A 3-hexenoic acid having the cis configuration. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|