| Identification | Back Directory | [Name]
cholesta-5,8(14)-dien-3-ol | [CAS]
177962-82-2 | [Synonyms]
8(14)-dehydrocholesterol cholesta-5,8(14)-dien-3-ol Cholesta-5,8(14)-dien-3-ol, (3β)- Cholesterol-5,8 (14) - diene-3- alcohol CHOLESTA-5,8(14)-DIEN-3-OL;8(14)-DEHYDROCHOLESTEROL | [Molecular Formula]
C27H44O | [MDL Number]
MFCD22416735 | [MOL File]
177962-82-2.mol | [Molecular Weight]
384.638 |
| Chemical Properties | Back Directory | [Boiling point ]
494.1±44.0 °C(Predicted) | [density ]
1.00±0.1 g/cm3(Predicted) | [storage temp. ]
-70°C | [form ]
powder | [pka]
15.01±0.70(Predicted) | [InChIKey]
DJNCIOAUQVURTQ-KVMRZRRHSA-N | [SMILES]
C[C@@]12C(CCC2C(CCCC(C)C)C)=C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC1 |
| Hazard Information | Back Directory | [Uses]
8(14)-Dehydrocholesterol is used in biochemical methods to analyze unsaturated C27 sterols by gas chromatography and mass spectrometry from an updated look. | [Biochem/physiol Actions]
8(14)-dehydrocholesterol is a cholestadienol. The free radical oxidation leads to abstraction of hydrogen at the bis-allylic positions leading to formation of D7-3,5-dihydroxycholest-7-en-6-one (DHCEO). |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Creative Enzymes
|
| Tel: |
1-516-855-7709 |
| Website: |
www.creative-enzymes.com |
|