| Identification | Back Directory | [Name]
METHYLPHENYLVINYLSILANE | [CAS]
17878-39-6 | [Synonyms]
METHYLPHENYLVINYLSILANE VINYLPHENYLMETHYLSILANE PHENYLMETHYLVINYLSILANE PHENYLMETHYLCINYLSILANE Methylvinylphenylsilane Phenyl Vinyl Methylsilane Ethenylmethylphenylsilane ethenylmethylphenyl-silan Methylphenylvinylsilane,97% | [EINECS(EC#)]
241-830-5 | [Molecular Formula]
C9H12Si | [MDL Number]
MFCD00053689 | [MOL File]
17878-39-6.mol | [Molecular Weight]
148.28 |
| Chemical Properties | Back Directory | [Appearance]
clear colorless liquid | [Boiling point ]
56-57 °C (7 mmHg)
| [density ]
0.89
| [refractive index ]
1.5125-1.5145
| [Fp ]
58°C | [Specific Gravity]
0.89 | [Hydrolytic Sensitivity]
3: reacts with aqueous base | [InChI]
InChI=1S/C9H12Si/c1-3-10(2)9-7-5-4-6-8-9/h3-8,10H,1H2,2H3 | [InChIKey]
JNRFDZNGKYQSKV-UHFFFAOYSA-N | [SMILES]
[SiH](C1C=CC=CC=1)(C)C=C | [EPA Substance Registry System]
Silane, ethenylmethylphenyl- (17878-39-6) |
|
|