| Chemical Properties | Back Directory | [InChI]
InChI=1S/C18H37N.HI/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-19H2,1H3;1H/b10-9-; | [InChIKey]
YXTZAIASMCAKDN-KVVVOXFISA-N | [SMILES]
C(/CCCCCCCCN)=C/CCCCCCCC.I |
| Hazard Information | Back Directory | [Application]
Oleylamine iodine can be used to prepare different types of perovskites, such as organic perovskites, inorganic perovskites, etc., and has a wide range of applications in the optoelectronic field.
| [Advantages]
Oleylammonium Iodide has the advantages for:
better photothermal stabilit;
Improve photoelectric conversion efficiency;
Significantly improve the conversion efficiency of perovskite films.
|
|
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
|