| Identification | Back Directory | [Name]
N-Fmoc-7-methyl-L-tryptophan | [CAS]
1808268-53-2 | [Synonyms]
Fmoc-7-Me-L-Trp-OH
Fmoc-7-Methyl-L-Trp-OH
N-Fmoc-7-methyl-L-tryptophan
FMOC-7-METHYL-L-TRYPTOPHAN-OH
N-Fmoc-7-methyl-L-tryptophan USP/EP/BP
L-Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-7-methyl-
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(7-methyl-1H-indol-3-yl)propanoic acid
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(7-methyl-1H-indol-3-yl)propanoic acid | [Molecular Formula]
C27H24N2O4 | [MDL Number]
MFCD31560627 | [MOL File]
1808268-53-2.mol | [Molecular Weight]
440.49 |
| Chemical Properties | Back Directory | [Boiling point ]
713.4±60.0 °C(Predicted) | [density ]
1.326±0.06 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [pka]
3.78±0.10(Predicted) | [Appearance]
White to off-white Solid | [InChIKey]
LIHWPPTURGLCAT-DEOSSOPVSA-N | [SMILES]
C(O)(=O)[C@H](CC1C2=C(C(C)=CC=C2)NC=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Information | Back Directory | [Uses]
N-Fmoc-7-methyl-L-tryptophan is a tryptophan derivative that appears as white crystals or a crystalline powder. This substance is a fundamental component of peptide drugs. Introducing non-natural amino acids into peptide drugs can significantly improve their stability, enhance their ability to cross the blood-brain barrier, and reduce their toxicity. Therefore, developing novel multifunctional non-natural amino acid blocks plays a crucial role in the research and development of peptide drugs. |
|
|