| Identification | Back Directory | [Name]
tert-butyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate | [CAS]
180975-66-0 | [Synonyms]
cis-1-Boc-2,6-diMethylpiperazine 1-Boc-(2S,6R)-2,6-diMethylpiperazine cis-tert-Butyl 2,6-dimethylpiperazine-1-carboxylate tert-butyl cis-2,6-dimethylpiperazine-1-carboxylate tert-butyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate (2R,6S)-tert-Butyl 2,6-diMethylpiperazine-1-carboxylate tert-butyl (2S,6R)-2,6-dimethylpiperazine-1-carboxylate rel-(2R,6S)-tert-Butyl 2,6-dimethylpiperazine-1-carboxylate (2R,6S)-rel-tert-Butyl 2,6-dimethylpiperazine-1-carboxylate cis-2,6-Dimethyl-1-piperazinecarboxylic acid 1,1-dimethylethyl ester tert-butyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate ISO 9001:2015 REACH 1-Piperazinecarboxylic acid, 2,6-diMethyl-, 1,1-diMethylethyl ester, (2R,6S)- 1-Piperazinecarboxylic acid, 2,6-dimethyl-, 1,1-dimethylethyl ester, (2R,6S)-rel- | [Molecular Formula]
C11H22N2O2 | [MDL Number]
MFCD09265026 | [MOL File]
180975-66-0.mol | [Molecular Weight]
214.31 |
| Chemical Properties | Back Directory | [Boiling point ]
279.7±15.0 °C(Predicted) | [density ]
0.970±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C(protect from light) | [pka]
8.53±0.60(Predicted) | [InChI]
InChI=1/C11H22N2O2/c1-8-6-12-7-9(2)13(8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9+ | [InChIKey]
RBOGBIZGALIITO-DTORHVGONA-N | [SMILES]
N1(C(OC(C)(C)C)=O)[C@@H](C)CNC[C@H]1C |&1:8,13,r| |
|
|