| Identification | Back Directory | [Name]
CPhos Pd G4 | [CAS]
1810068-32-6 | [Synonyms]
CPhos Pd G4 2'-(Dicyclohexylphosphino-κP)-N2,N2,N6,N6-tetramethyl[1,1'-biphenyl]-2,6-diamine](methanesulfonato-κO)[2'-(methylamino-κN)[1,1'-biphenyl]-2-yl-κC]palladium | [Molecular Formula]
C42H56N3O3PPdS | [MDL Number]
MFCD30724404 | [MOL File]
1810068-32-6.mol | [Molecular Weight]
820.38 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
powder or crystals | [Appearance]
Light yellow to yellow Solid | [InChIKey]
ZBDSBEXQDXJAOM-UHFFFAOYSA-M | [SMILES]
[Pd+]c5c(cccc5)c6c(cccc6)NC.P(C4CCCCC4)(C3CCCCC3)c1c(cccc1)c2c(cccc2N(C)C)N(C)C.[S](=O)(=O)([O-])C |
| Hazard Information | Back Directory | [Uses]
A fourth generation (G4) Buchwald precatalyst that is similar to the third generation (G3) precatalysts except that the amino group on the biphenyl backbone is methylated. This modification helps to prevent the limitations found when using the third generation precatalysts. It is air, moisture, and thermally-stable and shows good solubility in common organic solvents. | [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings |
|
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|