| Identification | Back Directory | [Name]
EUROPIUM(III) ACETYLACETONATE HYDRATE | [CAS]
181266-82-0 | [Synonyms]
Eu(acac)3 GLDOQTGHEKXAIO-KJVLTGTBSA-K Europium(III) 2,4-pentanedionate, hydrate, 99.9% Europium(III) acetylacetonate hydrate, 99.9% trace rare earth metals basis | [EINECS(EC#)]
626-341-0 | [Molecular Formula]
C15H21EuO6.H2O | [MDL Number]
MFCD00192170 | [MOL File]
181266-82-0.mol | [Molecular Weight]
467.3 |
| Chemical Properties | Back Directory | [Melting point ]
140°C | [form ]
solid | [Water Solubility ]
Insoluble in water. | [Sensitive ]
Hygroscopic | [InChI]
1S/3C5H8O2.Eu.H2O/c3*1-4(6)3-5(2)7;;/h3*3,6H,1-2H3;;1H2/q;;;+3;/p-3/b2*4-3+;4-3-;; | [InChIKey]
GLDOQTGHEKXAIO-HXGNVLNTSA-K | [SMILES]
O.CC(=O)\C=C(\C)O[Eu](O\C(C)=C\C(C)=O)O\C(C)=C\C(C)=O |
| Hazard Information | Back Directory | [Uses]
It is used in various catalysts and catalytic reagents for organic synthesis, including the fabrication of various shapes of?carbon?nanostructures. | [reaction suitability]
core: europium reagent type: catalyst |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|