| Identification | Back Directory | [Name]
Nonadecanedioic acid,10-oxo- | [CAS]
18197-46-1 | [Synonyms]
10-oxononadecanedioic acid
Nonadecanedioic acid,10-oxo- | [Molecular Formula]
C19H34O5 | [MDL Number]
MFCD34601784 | [MOL File]
18197-46-1.mol | [Molecular Weight]
342.47 |
| Chemical Properties | Back Directory | [Melting point ]
117-119.5 °C | [Boiling point ]
544.3±35.0 °C(Predicted) | [density ]
1.042±0.06 g/cm3(Predicted) | [pka]
4.48±0.10(Predicted) | [InChI]
InChI=1S/C19H34O5/c20-17(13-9-5-1-3-7-11-15-18(21)22)14-10-6-2-4-8-12-16-19(23)24/h1-16H2,(H,21,22)(H,23,24) | [InChIKey]
XOLMOPYKUVSLDQ-UHFFFAOYSA-N | [SMILES]
C(O)(=O)CCCCCCCCC(=O)CCCCCCCCC(O)=O |
| Hazard Information | Back Directory | [Description]
10-Oxononadecanedioic acid is a long alkane linker with two terminal carboxylic acid groups. The terminal carboxylic acid groups can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | [Uses]
10-Oxononadecanedioic acid is a long alkane linker with two terminal carboxylic acid groups. The terminal carboxylic acid groups can react with primary amine groups in the presence of activators (e.g. HATU) to form a stable amide bond. |
|
|