| Identification | Back Directory | [Name]
(R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate | [CAS]
1820679-70-6 | [Synonyms]
(R)-4-amino-1-Boc-3,3-difluoro-piperidine (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate 1-Piperidinecarboxylic acid, 4-amino-3,3-difluoro-, 1,1-dimethylethyl ester, (4R)- | [Molecular Formula]
C10H18F2N2O2 | [MDL Number]
MFCD30386986 | [MOL File]
1820679-70-6.mol | [Molecular Weight]
236.26 |
| Chemical Properties | Back Directory | [Boiling point ]
281.5±40.0 °C(Predicted) | [density ]
1.17±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light | [pka]
7.66±0.40(Predicted) | [Appearance]
White to off-white Solid | [Optical Rotation]
Consistent with structure | [InChI]
InChI=1S/C10H18F2N2O2/c1-9(2,3)16-8(15)14-5-4-7(13)10(11,12)6-14/h7H,4-6,13H2,1-3H3/t7-/m1/s1 | [InChIKey]
APZOOTJWPGQYSZ-SSDOTTSWSA-N | [SMILES]
N1(C(OC(C)(C)C)=O)CC[C@@H](N)C(F)(F)C1 |
|
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|