| Identification | Back Directory | [Name]
4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene | [CAS]
1830346-16-1 | [Synonyms]
Dapagliflozin-20 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene 4-Bromo-1-chloro-2-[(2-ethoxyphenyl)methyl]benzene Benzene, 4-bromo-1-chloro-2-[(2-ethoxyphenyl)methyl]- Canagliflozin impurity 1/4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene? (Dapagliflozin Impurity) (2S,3R,4R,5S,6R)-2-(3-((5-(2-fluorophenyl)thiophen-2-yl)methyl)-4- methylphenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol Dapagliflozin Impurity 2Q: What is
Dapagliflozin Impurity 2 Q: What is the CAS Number of
Dapagliflozin Impurity 2 Q: What is the storage condition of
Dapagliflozin Impurity 2 Q: What are the applications of
Dapagliflozin Impurity 2 | [Molecular Formula]
C15H14BrClO | [MDL Number]
MFCD32856660 | [MOL File]
1830346-16-1.mol | [Molecular Weight]
325.63 |
| Chemical Properties | Back Directory | [Boiling point ]
382.9±32.0 °C(Predicted) | [density ]
1.371±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C15H14BrClO/c1-2-18-15-6-4-3-5-11(15)9-12-10-13(16)7-8-14(12)17/h3-8,10H,2,9H2,1H3 | [InChIKey]
OJDCRWLGJWSFFT-UHFFFAOYSA-N | [SMILES]
C1(Cl)=CC=C(Br)C=C1CC1=CC=CC=C1OCC |
| Hazard Information | Back Directory | [Uses]
4-Bromo-1-chloro-2-[(2-ethoxyphenyl)methyl]benzene, is an impurity of Dapagliflozin (D185370), a sodium-glucose transporter 2 inhibitor. |
|
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18086626237 18086626237 |
| Website: |
www.chemicalbook.com/showsupplierproductslist16955/0.htm |
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
|