| Identification | Back Directory | [Name]
(S)-methyl((2-oxo-3-(4-(3-oxomorpholino)phenyl)oxazolidin-5-yl) methyl)carbamate | [CAS]
1838139-08-4 | [Synonyms]
Rivaroxaban-13 Methoxy Rivaroxaban Rivaroxaban Methyl Ester ImpurityQ: What is
Rivaroxaban Methyl Ester Impurity Q: What is the CAS Number of
Rivaroxaban Methyl Ester Impurity | [Molecular Formula]
C16H19N3O6 | [MOL File]
1838139-08-4.mol | [Molecular Weight]
349.34 |
| Chemical Properties | Back Directory | [Boiling point ]
642.7±50.0 °C(Predicted) | [density ]
1.355±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
11.69±0.46(Predicted) | [Major Application]
pharmaceutical small molecule | [InChI]
InChI=1S/C16H19N3O6/c1-23-15(21)17-8-13-9-19(16(22)25-13)12-4-2-11(3-5-12)18-6-7-24-10-14(18)20/h2-5,13H,6-10H2,1H3,(H,17,21) | [InChIKey]
IJJVHXIHIBEWFY-UHFFFAOYSA-N | [SMILES]
C(OC)(=O)NCC1OC(=O)N(C2=CC=C(N3CCOCC3=O)C=C2)C1 |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|