| Identification | Back Directory | [Name]
TH1020 | [CAS]
1841460-82-9 | [Synonyms]
TH1020
TH1020 >=95% (HPLC)
4-[[4-(Phenylmethyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-pyrido[3',2'
4-[[4-(Phenylmethyl)-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-pyrido[3',2':4,5]thieno[3,2-d]pyrimidine | [Molecular Formula]
C23H15N7S2 | [MDL Number]
MFCD30480930 | [MOL File]
1841460-82-9.mol | [Molecular Weight]
453.54 |
| Chemical Properties | Back Directory | [Boiling point ]
765.8±70.0 °C(Predicted) | [density ]
1.51±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
Chloroform: 1 mg/ml | [form ]
powder | [pka]
1.92±0.10(Predicted) | [color ]
white to beige | [InChI]
InChI=1S/C23H15N7S2/c1-2-5-15(6-3-1)13-30-20(16-8-11-24-12-9-16)28-29-23(30)32-22-19-18(26-14-27-22)17-7-4-10-25-21(17)31-19/h1-12,14H,13H2 | [InChIKey]
CBBXTGWSGPEJEE-UHFFFAOYSA-N | [SMILES]
C1=NC(SC2N(CC3=CC=CC=C3)C(C3C=CN=CC=3)=NN=2)=C2SC3=NC=CC=C3C2=N1 |
| Hazard Information | Back Directory | [Biochem/physiol Actions]
TH1020 is a non-cytotoxic non-cytotoxic toll-like receptor 5 (TLR5)/flagellin complex inhibitor. TH1020 selectively prevents flagellin-induced TLR5 signaling without affecting ligands-induced activation of TLR2, TLR3, TLR4, TLR7 or TLR8. | [IC 50]
TLR5 | [storage]
Store at +4°C |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|