| Identification | Back Directory | [Name]
[2',4'-Bis(1,1-dimethylethyl)-6'-methoxy[1,1'-biphenyl]-2-yl]dicyclohexylphosphine | [CAS]
1848244-75-6 | [Synonyms]
phosphino-2'-methoxy-4',6'-di-t-butyL 2-Dicyclohexylphosphino-2'-methoxy-4',6'-di-t-buty 2-Dicyclohexylphosphino-2′-methoxy-4′,6′-di-tert-butylbiphenyl 2-Dicyclohexylphosphino-2'-methoxy-4',6'-di-t-butyl-1,1'-biphenyl 2-Dicyclohexylphosphino-2'-methoxy-4',6'-di-t-butyl-1,1'-biphenyl, Vphos 2',4' -di-tert-butyl-6 '-methoxy-1,1' -biphenyl -2-dicyclohexylphosphine Dicyclohexyl(2',4'-di-tert-butyl-6'-methoxy-[1,1'-biphenyl]-2-yl)phosphane 2-Dicyclohexylphosphino-2'-methoxy-4',6'-di-t-butyl-1,1'-biphenyl,min.98%VPhos [2',4'-Bis(1,1-dimethylethyl)-6'-methoxy[1,1'-biphenyl]-2-yl]dicyclohexylphosphine Phosphine, [2',4'-bis(1,1-dimethylethyl)-6'-methoxy[1,1'-biphenyl]-2-yl]dicyclohexyl- | [Molecular Formula]
C33H49OP | [MDL Number]
MFCD30184625 | [MOL File]
1848244-75-6.mol | [Molecular Weight]
492.72 |
| Chemical Properties | Back Directory | [Melting point ]
113-118 °C | [Boiling point ]
561.5±50.0 °C(Predicted) | [storage temp. ]
Inert atmosphere,Store in freezer, under -20°C | [form ]
solid | [color ]
white to off-white | [InChI]
1S/C33H49OP/c1-32(2,3)24-22-28(33(4,5)6)31(29(23-24)34-7)27-20-14-15-21-30(27)35(25-16-10-8-11-17-25)26-18-12-9-13-19-26/h14-15,20-23,25-26H,8-13,16-19H2,1-7H3 | [InChIKey]
LYVFKWGKMKCNPE-UHFFFAOYSA-N | [SMILES]
P(C1=CC=CC=C1C1=C(OC)C=C(C(C)(C)C)C=C1C(C)(C)C)(C1CCCCC1)C1CCCCC1 |
| Hazard Information | Back Directory | [Uses]
As the Pd G4 complex, this ligand from the Buchwald group offers best-in-class performance in the micellar aqueous Negishi coupling of heterocyclic alkyl bromides. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings reagent type: ligand reaction type: click chemistry |
|
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|