| Identification | Back Directory | [Name]
(R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL | [CAS]
185913-97-7 | [Synonyms]
(S)-CL-MEO-BIPHEP
(R)-CL-MEO-BIPHEP
min.(r)-cl-meo-biphep
(+)-5,5'-DICHLORO-2,2'-BIS(DIPHE.PHOS)6,6'-DIMETHOXYBIPHENYL
(-)-2,2'-BIS(DIPHENYLPHOSPHINO)-5,5'-DICHLORO-6,6'-DIMETHOXY-1,1'-BIPHENYL
(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-5,5'-DICHLORO-6,6'-DIMETHOXY-1,1'-BIPHENYL
(-)-5,5'-DICHLORO-2,2'-BIS(DIPHENYLPHOSPHINO)-6,6'-DIMETHOXY-1,1'-BIPHENYL
(+)-5,5'-DICHLORO-2,2'-BIS(DIPHENYLPHOSPHINO)-6,6'-DIMETHOXY-1,1'-BIPHENYL
(R)-(+)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL
(S)-(-)-5,5'-DICHLORO-6,6'-DIMETHOXY-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BIPHENYL
(s)-(+)-5,5'-dichloro-2,2'-bis(diphenylphosphino)-6,6'-dimethoxy-1,1'-biphenyl
(-)-(5,5'-DICHLORO-6,6'-DIMETHOXY-1,1'-BIPHENYL)-2,2'-DIYL-BIS(DIPHENYLPHOSPHINE)
(+)-(5,5'-DICHLORO-6,6'-DIMETHOXY-1,1'-BIPHENYL)-2,2'-DIYL-BIS(DIPHENYLPHOSPHINE)
(R)-(+)-5,5'-Dichloro-6,6'- diMethoxy-2,2'-bis(diphenylphosphino)-1,1'-biphenyl (R)-Cl-MeO-BIPHEP
(R)-(+)-5,5'-Dichloro-6,6'-dimethoxy-2,2'-bis(diphenylphosphino)-1,1'-biphenyl,min.95%(R)-Cl-MeO-BIPHEP | [Molecular Formula]
C38H30Cl2O2P2 | [MDL Number]
MFCD03426987 | [MOL File]
185913-97-7.mol | [Molecular Weight]
651.5 |
| Chemical Properties | Back Directory | [Melting point ]
176-180 °C
| [Boiling point ]
678.2±55.0 °C(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
Powder | [color ]
yellow-white | [Optical Rotation]
[α]/D +59±4°, c = 1% in chloroform | [InChIKey]
GCBRCSSVOVNEIX-UHFFFAOYSA-N | [SMILES]
C1(C(OC)=C(C=CC=1P(C1=CC=CC=C1)C1C=CC=CC=1)Cl)C1=C(OC)C(=CC=C1P(C1=CC=CC=C1)C1C=CC=CC=1)Cl |
| Questions And Answer | Back Directory | [Description]
1. Ligand used in the ruthenium catalyzed, enantioselective hydrogenation of alkenes, carbonyls, and imines.
2. Ligand used in the rhodium-catalyzed cyclization of acetylenic aldehydes.
3. Ligand used in the iridium-catalyzed hydrogenative coupling of alkynes to aromatic and aliphatic N-arylsulfonyl aldimines.
4. Asymmetric Cu-catalyzed propargylic substitution with amines,4a and enamines.4b
5. Catalytic desymmetrizing intramolecular Heck reaction.
6. Assembly of 1,3-polyols.
7. Pd-catalyzed diastereo/enantioselective allylic alkylations of ketone enolates.
8. Enantioselective vinylogous Reformatsky-type addition.
9. Cu-catalyzed chemoselective preparation of 2-(pinacolato)boron- substituted allylcopper complexes.
and their In situ site-, diastereo-, and enantioselective additions to ketones.
 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|