| Identification | Back Directory | [Name]
L-Menthyl lactate
| [CAS]
185915-25-7 | [Synonyms]
L-Menthyl lactate >=97%, FG
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-hydroxypropanoate
Propanoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester | [Molecular Formula]
C13H24O3 | [MDL Number]
MFCD09037384 | [MOL File]
185915-25-7.mol | [Molecular Weight]
228.33 |
| Chemical Properties | Back Directory | [Melting point ]
42-47°C (lit.) | [density ]
0.99±0.1 g/cm3(Predicted) | [Fp ]
>113℃ | [pka]
13.01±0.20(Predicted) | [biological source]
synthetic | [Optical Rotation]
[α]20/D -81°, c = 5 in ethanol | [Boiling point ]
142°C/5 mmHg(lit.) | [Major Application]
flavors and fragrances | [InChI]
1S/C13H24O3/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-12,14H,5-7H2,1-4H3/t9-,10?,11+,12-/m1/s1 | [InChIKey]
UJNOLBSYLSYIBM-SGUBAKSOSA-N | [SMILES]
CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@H](C)O |
| Hazard Information | Back Directory | [Uses]
L-Menthyllactate is used as a cooling ingredient with a pleasant and long-lastingcooling effect in products like toothpaste mints and chewing gum. (2) | [Biological Activity]
Odor at 1.0%', 'Taste at 25 ppm |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|