| Identification | Back Directory | [Name]
(9H-Fluoren-9-yl)MethOxy]Carbonyl Ala-Pro-OH | [CAS]
186023-44-9 | [Synonyms]
N-Fmoc-L-Alanyl-L-proline
Fmoc-Ala-Pro-OH (B-4415.0001)
(9H-Fluoren-9-yl)MethOxy]Carbonyl Ala-Pro-OH
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-proline
L-Proline, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanyl-
(2S)-1-[(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoyl]pyrrolidine-2-carboxylic acid | [Molecular Formula]
C23H24N2O5 | [MDL Number]
MFCD00190871 | [MOL File]
186023-44-9.mol | [Molecular Weight]
408.45 |
| Chemical Properties | Back Directory | [Boiling point ]
674.0±55.0 °C(Predicted) | [density ]
1.318±0.06 g/cm3(Predicted) | [pka]
3.51±0.20(Predicted) | [InChIKey]
HLFCRSYTJCARCY-XOBRGWDASA-N | [SMILES]
C(O)(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Information | Back Directory | [Description]
Fmoc-Ala-Pro-OH is a linker with an Fmoc-protected amine and a terminal carboxylic acid. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | [Uses]
Fmoc-Ala-Pro-OH is a linker with an Fmoc-protected amine and a terminal carboxylic acid. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. |
|
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Telephone: |
+86-21-61263310 13764994101 |
| Website: |
www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Abydos Scientific
|
| Telephone: |
18936879710 18851749494 |
| Website: |
www.abydoscientific.com/index.html |
| Company Name: |
GL Biochem (Shanghai) Ltd.
|
| Telephone: |
+86-021-61263370 +86-18901917034 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList212835/0_EN.htm |
| Company Name: |
Nextpeptide Inc
|
| Telephone: |
+86-0571-81612335 +8613336028439 |
| Website: |
http://www.nextpeptide.com/ |
| Company Name: |
GL Biochem(Binhai) Ltd.
|
| Telephone: |
+86-021-61263370 15301650015 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList415547/0_EN.htm |
| Company Name: |
Binhai gill polypeptide co. LTD
|
| Telephone: |
021-61263389 13524856427 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList326362/0_EN.htm |
|