| Identification | Back Directory | [Name]
4-DIPHENYLACETOXY-N-METHYLPIPERIDINE METHIODIDE | [CAS]
1952-15-4 | [Synonyms]
4-DAMP 4-DAMP METHIODIDE WWJHRSCUAQPFQO-UHFFFAOYSA-N 4-DAMP METHIODIDE M3 CHOLINERGIC RECEPT 4-DIPHENYLACETOXY-N-METHYLPIPERIDINE METHIODIDE 1,1-DIMETHYL-4-DIPHENYLACETOXYPIPERIDINIUM IODIDE 4-DIPHENYLACETOXY-N-METHYL- PIPERIDINE METHIODIDE 98+% 4-[(Diphenylacetyl)oxy]-1,1-dimethyl-piperidinium iodide 4-(2,2-Diphenylacetoxy)-1,1-dimethylpiperidin-1-iumiodide 1-Methylpiperidin-4-yl 2,2-diphenylacetate compound with iodomethane (1:1) | [Molecular Formula]
C21H26INO2 | [MDL Number]
MFCD00078564 | [MOL File]
1952-15-4.mol | [Molecular Weight]
451.34 |
| Chemical Properties | Back Directory | [Melting point ]
211-213℃ | [storage temp. ]
room temp | [solubility ]
H2O: 3 mg/mL | [form ]
powder | [color ]
white | [Stability:]
Hygroscopic | [InChI]
1S/C21H26NO2.HI/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19-20H,13-16H2,1-2H3;1H/q+1;/p-1 | [InChIKey]
WWJHRSCUAQPFQO-UHFFFAOYSA-M | [SMILES]
[I-].C[N+]1(C)CCC(CC1)OC(=O)C(c2ccccc2)c3ccccc3 |
| Hazard Information | Back Directory | [Uses]
4-DAMP is a potent muscarinic M3 receptor antagonist. | [Definition]
ChEBI: A quaternary ammonium salt obtained by combining equimolar amounts of 4-diphenylacetoxy-N-methylpiperidine and iodomethane. | [Biological Activity]
Antagonist at the M 3 cholinergic receptor. [ 3 H]-4-DAMP selectively labels M 1 and M 3 receptors. | [Biochem/physiol Actions]
4-DAMP is a M3 preferring cholinergic receptor antagonist. | [storage]
Room temperature |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|