| Identification | Back Directory | [Name]
(R)-Ramelteon | [CAS]
196597-27-0 | [Synonyms]
(R)-Ramelteon
Ramelteon R-Isomer
Ramelteon Impurity P
Ramelteon Impurity 20
N-{2-[(8R)-1H,2H,6H,7H,8H-indeno[5,4-b]furan-8-yl
]ethyl}propanamide
PropanaMide, N-[2-[(8R)-1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]- | [Molecular Formula]
C16H21NO2 | [MOL File]
196597-27-0.mol | [Molecular Weight]
259.34 |
| Chemical Properties | Back Directory | [Boiling point ]
455.3±24.0 °C(Predicted) | [density ]
1.119±0.06 g/cm3(Predicted) | [pka]
16.37±0.46(Predicted) | [InChI]
InChI=1S/C16H21NO2/c1-2-15(18)17-9-7-12-4-3-11-5-6-14-13(16(11)12)8-10-19-14/h5-6,12H,2-4,7-10H2,1H3,(H,17,18)/t12-/m1/s1 | [InChIKey]
YLXDSYKOBKBWJQ-GFCCVEGCSA-N | [SMILES]
C(NCC[C@@H]1C2=C3CCOC3=CC=C2CC1)(=O)CC |
| Hazard Information | Back Directory | [Uses]
(R)-Ramelteon is an enantiomer of Ramelteon (R110051), an Melatonin MT1/MT2 receptor agonist. Ramelteon is also known to exert sedative and hypnotic activities. |
|
| Company Name: |
SPIRO PHARMA
|
| Tel: |
|
| Website: |
www.spiropharma.com.cn |
| Company Name: |
Roark Standards
|
| Tel: |
0755-83552066 15986688328 |
| Website: |
roarkstandards.com |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
|