| Identification | Back Directory | [Name]
2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE | [CAS]
1991-52-2 | [Synonyms]
2,5-DI-TERT-BUTYL-HYDROXYANISOLE 2,5-DI-TERT-BUTYL-4-METHOXYPHENOL 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE 2,5- Di-tert-butyl 4-hydroxyanizole 2,5-Di-tert-butyl-4-methoxyphenol 97% Phenol, 2,5-bis(1,1-dimethylethyl)-4-methoxy- | [EINECS(EC#)]
217-873-0 | [Molecular Formula]
C15H24O2 | [MDL Number]
MFCD00274238 | [MOL File]
1991-52-2.mol | [Molecular Weight]
236.35 |
| Chemical Properties | Back Directory | [Melting point ]
99-102 °C(lit.)
| [Boiling point ]
337.8±42.0 °C(Predicted) | [density ]
0.963±0.06 g/cm3(Predicted) | [form ]
Crystalline Powder | [pka]
11.97±0.23(Predicted) | [color ]
White to cream | [InChI]
1S/C15H24O2/c1-14(2,3)10-9-13(17-7)11(8-12(10)16)15(4,5)6/h8-9,16H,1-7H3 | [InChIKey]
FLLRQABPKFCXSO-UHFFFAOYSA-N | [SMILES]
COc1cc(c(O)cc1C(C)(C)C)C(C)(C)C |
| Hazard Information | Back Directory | [Uses]
2,5-Di-tert-butyl-4-methoxyphenol is used as a non-tumorigenic compound in contrast to DBHQ. | [Definition]
ChEBI: 2,5-ditert-butyl-4-methoxyphenol is a member of phenols and a member of methoxybenzenes. |
|
| Company Name: |
INTATRADE GmbH
|
| Tel: |
+49 3493/605464 |
| Website: |
www.intatrade.de |
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|