| Chemical Properties | Back Directory | [Boiling point ]
655.2±55.0 °C(Predicted) | [density ]
1.10±0.1 g/cm3(Predicted) | [pka]
13.62±0.70(Predicted) | [InChIKey]
KXLYTOWHSZWHSQ-MZBQCLPSNA-N | [SMILES]
C[C@]12CCC=C(/C=C\C3C[C@@H](O)[C@@H](OCCCO)[C@H](O)C=3C)[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C |&1:1,10,12,18,22,26,28,r| |
| Hazard Information | Back Directory | [Uses]
Eldecalcitol is a derivative of vitamin D3 (V676045) which is the vitamin that mediates intestinal calcium absorbtion, bone calcium metabolism and probably, muscle activity. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Pharma Affiliates
|
| Tel: |
172-5066494 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList694812/0_EN.htm |
|