| Identification | Back Directory | [Name]
L-4-HYDROXYPHENYLALANINE-13C9,15N | [CAS]
202407-26-9 | [Synonyms]
L-TYROSINE-13C9,15N
[13C9,15N]-L-Tyrosine
L-TYROSINE (U-13C9, 15N)
L-4-HYDROXYPHENYLALANINE-13C9,15N | [Molecular Formula]
C9H11NO3 | [MDL Number]
MFCD00144701 | [MOL File]
202407-26-9.mol | [Molecular Weight]
191.28 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C (dec.)(lit.) | [storage temp. ]
Refrigerator | [solubility ]
Aqueous Acid (Slightly) | [form ]
Solid | [color ]
White to Off-White | [Optical Rotation]
[α]25/D -12.0°, c = 1 in 1 M HCl | [InChI]
1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 | [InChIKey]
OUYCCCASQSFEME-CMLFETTRSA-N | [SMILES]
[15NH2][13C@@H]([13CH2][13c]1[13cH][13cH][13c](O)[13cH][13cH]1)[13C](O)=O |
| Hazard Information | Back Directory | [Uses]
L-Tyrosine-13C9 ,15N is labelled analogue of L-Tyrosine (T899975), one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. | [storage]
-20°C |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
ChemeGen
|
| Tel: |
18818260767 |
| Website: |
https://www.chemegen.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|