| Identification | Back Directory | [Name]
15N4, 99%) | [CAS]
202468-25-5 | [Synonyms]
15N4) 15N4, 99%) L-ARGININE:HCL (13C6, 99% L-Arginine-13C,15N4 hydrochloride [13C6,15N4]-L-Arginine Hydrochloride "L-ARGININE Hydrochloride 13C6, 15N4" | [Molecular Formula]
C6H15ClN4O2 | [MOL File]
202468-25-5.mol | [Molecular Weight]
220.752 |
| Chemical Properties | Back Directory | [Melting point ]
226-230°C (dec.) (lit.) | [storage temp. ]
Store at -20°C | [solubility ]
Methanol (Slightly), Water (Sparingly) | [form ]
Solid | [color ]
White to Off-White | [Optical Rotation]
[α]20/D +22°, c = 12 in 10% HCl | [Stability:]
Hygroscopic | [InChI]
1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1; | [InChIKey]
KWTQSFXGGICVPE-YAUSPDTOSA-N | [SMILES]
Cl.[15NH2][13C@@H]([13CH2][13CH2][13CH2][15NH][13C]([15NH2])=[15NH])[13C](O)=O | [CAS Number Unlabeled]
1119-34-2 |
| Hazard Information | Back Directory | [Uses]
Pulsed Stable Isotope labeling of amino acid has been used to study host-cell function, survival, the precise intracellular pathways in protein synthesis of HIV-1 infected human monocytederived macrophages. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Chinapeptide
|
| Tel: |
15295566865 |
| Website: |
http://www.synpeptide.cn |
|