| Identification | Back Directory | [Name]
Benzo[b]thiophene, 6-fluoro- (9CI) | [CAS]
205055-10-3 | [Synonyms]
6-fluorobenzo[b]thiophene 6-fluoro-1-benzothiophene Benzo[b]thiophene, 6-fluoro- Benzo[b]thiophene, 6-fluoro- (9CI) me: Benzo[b]thiophene, 6-fluoro- (9CI) Benzo[b]thiophene, 6-fluoro- (9CI) ISO 9001:2015 REACH | [Molecular Formula]
C8H5FS | [MDL Number]
MFCD18207210 | [MOL File]
205055-10-3.mol | [Molecular Weight]
152.19 |
| Chemical Properties | Back Directory | [Boiling point ]
226.2±13.0 °C(Predicted) | [density ]
1.298±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [InChI]
InChI=1S/C8H5FS/c9-7-2-1-6-3-4-10-8(6)5-7/h1-5H | [InChIKey]
IAWIFBMBSZRKGZ-UHFFFAOYSA-N | [SMILES]
C12=CC(F)=CC=C1C=CS2 |
|
| Company Name: |
Tetranov Biopharm
|
| Tel: |
13526569071 |
| Website: |
www.leadmedpharm.com/index.html |
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
|