| Identification | Back Directory | [Name]
(Z)-11-TETRADECEN-1-YL ACETATE | [CAS]
20711-10-8 | [Synonyms]
Z11-14Ac Z-11-TDA Ai3-28959 (Z)-11-TDA Z11-14: Acetate Einecs 243-982-8 (z)-11-tetradecenyl cis-11-tetradecenyl Z-11-Tetradecenol acetate (z)-11-tetradecenylacetate CIS-11-TETRADECENYL ACETATE (Z)-tetradec-11-enyl acetate cis-11-tetradecen-1-ylacetate (11Z)-11-Tetradecenyl acetate (e)-11-tetradecen-1-olacetate acetate,(z)-11-tetradecen-1-o cis-11-Tetradecen-1-ol acetate cis-11-Tetradecen-1-yl acetate (Z)-11-Tetradecen-1-ol acetate (Z)-11-TETRADECEN-1-YL ACETATE (11Z)-11-Tetradecen-1-ol acetate (11Z)-tetradec-11-en-1-yl acetate Acetic acid (11Z)-11-tetradecenyl 11-Tetradecen-1-ol, acetate, (Z)- 11-Tetradecen-1-ol, acetate, (11Z)- Acetic acid (Z)-11-tetradecenyl ester 11-Tetradecen-1-ol, 1-acetate, (11Z)- Acetic acid (11Z)-11-tetradecenyl ester | [EINECS(EC#)]
243-982-8 | [Molecular Formula]
C16H30O2 | [MDL Number]
MFCD00009869 | [MOL File]
20711-10-8.mol | [Molecular Weight]
254.41 |
| Chemical Properties | Back Directory | [Melting point ]
<25℃ | [Boiling point ]
316.2±11.0℃ (760 torr) | [density ]
0.878±0.06 g/cm3 (20 ºC 760 Torr) | [refractive index ]
1.4515 (20℃) | [Fp ]
87.2±17.6℃ | [storage temp. ]
2-8°C | [solubility ]
Chloroform, Methanol (Sparingly) | [form ]
Oil | [color ]
Colourless | [InChI]
InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-5H,3,6-15H2,1-2H3/b5-4- | [InChIKey]
YJINQJFQLQIYHX-PLNGDYQASA-N | [SMILES]
C(OC(=O)C)CCCCCCCCC/C=C\CC | [LogP]
6.490 (est) | [CAS DataBase Reference]
20711-10-8 | [EPA Substance Registry System]
(Z)-11-Tetradecen-1-ol acetate (20711-10-8) |
| Hazard Information | Back Directory | [Uses]
(Z)-11-Tetradecenyl Acetate is a sex pheremone component that can be found in various insect specie, such as O. nubilalis and Asian and European corn borers. | [Definition]
ChEBI: 11Z-Tetradecenyl acetate is a carboxylic ester. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
|