| Identification | Back Directory | [Name]
6-METHYLCHROMONE HYDRATE, 98% | [CAS]
207511-19-1 | [Synonyms]
6-Methylchromone hydrate,99% 6-Methyl chroMone hydrate,98% | [Molecular Formula]
C10H10O3 | [MDL Number]
MFCD00209598 | [MOL File]
207511-19-1.mol |
| Chemical Properties | Back Directory | [Appearance]
White crystalline powder | [Melting point ]
76-78 °C(lit.) | [form ]
Crystalline Powder | [color ]
White | [InChI]
1S/C10H8O2.H2O/c1-7-2-3-10-8(6-7)9(11)4-5-12-10;/h2-6H,1H3;1H2 | [InChIKey]
QWIQUUMSUBFRAX-UHFFFAOYSA-N | [SMILES]
[H]O[H].Cc1ccc2OC=CC(=O)c2c1 |
| Hazard Information | Back Directory | [Chemical Properties]
White crystalline powder | [Uses]
6-Methylchromone may be employed as activated alkene in the methanolic trimethylamine or sodium methoxide catalyzed Baylis-Hillman coupling reaction with aromatic and aliphatic aldehydes. | [General Description]
6-Methylchromone hydrate is a chromone derivative. Chromones are cyclic compounds containing nine carbon atoms with sp2 hybridization. They are commonly referred as 1,4-benzapyranes or γ-benzopyrones. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Acros Organics
|
| Tel: |
+32 14/57.52.11 |
| Website: |
www.acros.be |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|